AB60720
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $48.00 | $34.00 | - + | |
25g | 95% | in stock | $105.00 | $74.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60720 |
Chemical Name: | 2,6-Dinitro-p-cresol, wetted with ca 20% of water |
CAS Number: | 609-93-8 |
Molecular Formula: | C7H6N2O5 |
Molecular Weight: | 198.1329 |
MDL Number: | MFCD00007121 |
SMILES: | Cc1cc([N+](=O)[O-])c(c(c1)[N+](=O)[O-])O |
NSC Number: | 33870 |
Complexity: | 221 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.7 |
Journal of environmental quality 20110101
Environmental toxicology and chemistry 20090701
Chemosphere 20090501
Journal of the American Chemical Society 20030910
Chemosphere 20020201