logo
Home  > Chemistry  > Organic Building Blocks  > Nitroes  > 3-Methyl-4-nitroaniline

AI53612

611-05-2 | 3-Methyl-4-nitroaniline

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $10.00 $7.00 -   +
1g 97% in stock $12.00 $8.00 -   +
5g 97% in stock $18.00 $12.00 -   +
10g 97% in stock $24.00 $17.00 -   +
25g 97% in stock $41.00 $29.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI53612
Chemical Name: 3-Methyl-4-nitroaniline
CAS Number: 611-05-2
Molecular Formula: C7H8N2O2
Molecular Weight: 152.1506
MDL Number: MFCD00091833
SMILES: Nc1ccc(c(c1)C)[N+](=O)[O-]
NSC Number: 17041

 

Computed Properties
Complexity: 155  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 11  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
XLogP3: 2.2  

 

 

Upstream Synthesis Route
  • 3-Methyl-4-nitroaniline, also known as MNMA, is a versatile chemical compound commonly used in chemical synthesis processes. Its application in organic chemistry lies in its ability to serve as a crucial intermediate in the synthesis of various pharmaceuticals, dyes, and agrochemicals. In chemical synthesis, 3-Methyl-4-nitroaniline can be utilized as a starting material for the production of several important compounds. One of the key applications is its use in the synthesis of dyes and pigments, where it serves as a building block for the creation of vibrant and colorfast coloring agents. Additionally, due to its aromatic properties and nitro group, it can be further functionalized to introduce other desired chemical groups, thereby enabling the creation of tailored molecules for specific applications.Furthermore, 3-Methyl-4-nitroaniline plays a significant role in pharmaceutical synthesis, particularly in the development of potential drug candidates. Its unique chemical structure allows for the modification and incorporation of various functional groups, making it a valuable precursor in the production of pharmaceutical intermediates and active pharmaceutical ingredients.Overall, the versatility and reactivity of 3-Methyl-4-nitroaniline make it a crucial component in chemical synthesis, enabling the creation of a wide range of compounds with diverse applications in industries such as pharmaceuticals, dyes, and agrochemicals.
FEATURED PRODUCTS