AI53612
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $10.00 | $7.00 | - + | |
1g | 97% | in stock | $12.00 | $8.00 | - + | |
5g | 97% | in stock | $18.00 | $12.00 | - + | |
10g | 97% | in stock | $24.00 | $17.00 | - + | |
25g | 97% | in stock | $41.00 | $29.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI53612 |
Chemical Name: | 3-Methyl-4-nitroaniline |
CAS Number: | 611-05-2 |
Molecular Formula: | C7H8N2O2 |
Molecular Weight: | 152.1506 |
MDL Number: | MFCD00091833 |
SMILES: | Nc1ccc(c(c1)C)[N+](=O)[O-] |
NSC Number: | 17041 |
Complexity: | 155 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.2 |
3-Methyl-4-nitroaniline, also known as MNMA, is a versatile chemical compound commonly used in chemical synthesis processes. Its application in organic chemistry lies in its ability to serve as a crucial intermediate in the synthesis of various pharmaceuticals, dyes, and agrochemicals. In chemical synthesis, 3-Methyl-4-nitroaniline can be utilized as a starting material for the production of several important compounds. One of the key applications is its use in the synthesis of dyes and pigments, where it serves as a building block for the creation of vibrant and colorfast coloring agents. Additionally, due to its aromatic properties and nitro group, it can be further functionalized to introduce other desired chemical groups, thereby enabling the creation of tailored molecules for specific applications.Furthermore, 3-Methyl-4-nitroaniline plays a significant role in pharmaceutical synthesis, particularly in the development of potential drug candidates. Its unique chemical structure allows for the modification and incorporation of various functional groups, making it a valuable precursor in the production of pharmaceutical intermediates and active pharmaceutical ingredients.Overall, the versatility and reactivity of 3-Methyl-4-nitroaniline make it a crucial component in chemical synthesis, enabling the creation of a wide range of compounds with diverse applications in industries such as pharmaceuticals, dyes, and agrochemicals.