AB50924
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $6.00 | - + | |
1g | 95% | in stock | $10.00 | $7.00 | - + | |
5g | 95% | in stock | $42.00 | $30.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50924 |
Chemical Name: | 4-Amino-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-iodopyrimidin-2(1H)-one |
CAS Number: | 611-53-0 |
Molecular Formula: | C9H12IN3O4 |
Molecular Weight: | 353.1137 |
MDL Number: | MFCD00038063 |
SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1cc(I)c(nc1=O)N |
Complexity: | 398 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.7 |
Chemistry (Weinheim an der Bergstrasse, Germany) 20111202
The Journal of organic chemistry 20070706
Cancer gene therapy 20040601
The Journal of biological chemistry 20020419
Nucleic acids research. Supplement (2001) 20010101
FEMS microbiology letters 19981101
Antimicrobial agents and chemotherapy 19820101
Antimicrobial agents and chemotherapy 19791101
Journal of medicinal chemistry 19790101