AB45473
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $78.00 | $54.00 | - + | |
5mg | ≥98% | in stock | $295.00 | $207.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45473 |
Chemical Name: | 7-Methyl-1H-purine-2,6,8(3H,7H,9H)-trione |
CAS Number: | 612-37-3 |
Molecular Formula: | C6H6N4O3 |
Molecular Weight: | 182.1368 |
MDL Number: | MFCD00042772 |
SMILES: | O=c1[nH]c2[nH]c(=O)n(c2c(=O)[nH]1)C |
Complexity: | 359 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
XLogP3: | -1.2 |
Clinical chemistry 20050801
Bioorganic & medicinal chemistry letters 20050215
Frontiers in bioscience : a journal and virtual library 20040501
Journal of medicinal chemistry 20011220
Journal of chromatography. B, Biomedical sciences and applications 20010815