AB58434
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $26.00 | $18.00 | - + | |
2mg | 98% | in stock | $32.00 | $22.00 | - + | |
5mg | 98% | in stock | $42.00 | $29.00 | - + | |
10mg | 98% | in stock | $58.00 | $40.00 | - + | |
50mg | 98% | in stock | $149.00 | $104.00 | - + | |
100mg | 98% | in stock | $239.00 | $167.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB58434 |
Chemical Name: | 2-hydroxy-3-[5-(4-morpholinylmethyl)-2-pyridinyl]-1H-indole-5-carbonitrile |
CAS Number: | 612487-72-6 |
Molecular Formula: | C19H18N4O2 |
Molecular Weight: | 334.3718 |
MDL Number: | MFCD12031593 |
SMILES: | N#Cc1ccc2c(c1)c(c1ccc(cn1)CN1CCOCC1)c([nH]2)O |
Complexity: | 501 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.8 |
Journal of neurochemistry 20130501