AB69991
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $12.00 | $8.00 | - + | |
10g | 98% | in stock | $21.00 | $15.00 | - + | |
25g | 98% | in stock | $28.00 | $19.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69991 |
Chemical Name: | 6-Nitroquinoline |
CAS Number: | 613-50-3 |
Molecular Formula: | C9H6N2O2 |
Molecular Weight: | 174.15614000000002 |
MDL Number: | MFCD00006799 |
SMILES: | [O-][N+](=O)c1ccc2c(c1)cccn2 |
NSC Number: | 4141 |
Complexity: | 202 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 1.8 |
6-Nitroquinoline is a versatile compound widely used in chemical synthesis as a key building block for the preparation of various organic molecules. Its unique chemical properties make it a valuable tool for creating a variety of pharmaceuticals, agrochemicals, and materials. In organic synthesis, 6-Nitroquinoline serves as an important intermediate for the synthesis of heterocyclic compounds, which are essential in drug development and other fields. The nitro group on the quinoline ring can undergo various transformation reactions, such as reduction, substitution, and functional group interconversion, allowing for the generation of diverse molecular structures. Additionally, 6-Nitroquinoline can participate in metal-catalyzed reactions, enabling the formation of complex molecules with high efficiency and selectivity. Its versatile reactivity and compatibility with different synthetic methodologies make it a valuable asset in the toolkit of synthetic chemists working in various research areas.
The Journal of organic chemistry 20120406
Rapid communications in mass spectrometry : RCM 20080801
Yakugaku zasshi : Journal of the Pharmaceutical Society of Japan 20010601