AG67067
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $105.00 | $74.00 | - + | |
1g | 97% | in stock | $265.00 | $186.00 | - + | |
5g | 97% | in stock | $789.00 | $553.00 | - + | |
10g | 97% | in stock | $1,178.00 | $824.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG67067 |
Chemical Name: | 2-Chloro-N-(4-(4-methoxyphenyl)thiazol-2-yl)acetamide |
CAS Number: | 6202-74-0 |
Molecular Formula: | C12H11ClN2O2S |
Molecular Weight: | 282.7459 |
MDL Number: | MFCD01922982 |
SMILES: | ClCC(=O)Nc1scc(n1)c1ccc(cc1)OC |
Complexity: | 285 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.7 |
Bioinorganic chemistry and applications 20070101