AG65981
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $11.00 | $8.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $46.00 | $32.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG65981 |
Chemical Name: | Boc-3,5-diiodo-l-tyrosine |
CAS Number: | 62129-53-7 |
Molecular Formula: | C14H17I2NO5 |
Molecular Weight: | 533.09742 |
MDL Number: | MFCD00058515 |
SMILES: | OC(=O)[C@H](Cc1cc(I)c(c(c1)I)O)NC(=O)OC(C)(C)C |
Complexity: | 401 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.5 |
Journal of medicinal chemistry 20040506