AB43519
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $9.00 | $6.00 | - + | |
5g | 98% | in stock | $13.00 | $9.00 | - + | |
10g | 98% | in stock | $19.00 | $13.00 | - + | |
25g | 98% | in stock | $23.00 | $16.00 | - + | |
100g | 98% | in stock | $70.00 | $49.00 | - + | |
250g | 98% | in stock | $146.00 | $102.00 | - + | |
500g | 98% | in stock | $265.00 | $185.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43519 |
Chemical Name: | 2,2,2-Trifluoroethyl trifluoromethanesulfonate |
CAS Number: | 6226-25-1 |
Molecular Formula: | C3H2F6O3S |
Molecular Weight: | 232.1016 |
MDL Number: | MFCD00671579 |
SMILES: | FC(COS(=O)(=O)C(F)(F)F)(F)F |
Complexity: | 254 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 9 |
Rotatable Bond Count: | 2 |
XLogP3: | 2 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20040201