AG69075
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 95% | in stock | $89.00 | $62.00 | - + | |
10mg | 95% | in stock | $121.00 | $85.00 | - + | |
250mg | 95% | in stock | $175.00 | $122.00 | - + | |
1g | 95% | in stock | $606.00 | $424.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG69075 |
Chemical Name: | ISOPROPYL 3-(3,4-DIFLUOROBENZOYL)-1,1-DIMETHYL-1,2,3,6-TETRAHYDROAZEPINO[4,5-B]INDOLE-5-CARBOXYLATE |
CAS Number: | 629664-81-9 |
Molecular Formula: | C25H24F2N2O3 |
Molecular Weight: | 438.4665 |
MDL Number: | MFCD13181507 |
SMILES: | CC(OC(=O)C1=CN(CC(c2c1[nH]c1c2cccc1)(C)C)C(=O)c1ccc(c(c1)F)F)C |
Complexity: | 768 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 5.1 |
Bioorganic & medicinal chemistry letters 20130801
The Journal of pharmacology and experimental therapeutics 20121201
Yao xue xue bao = Acta pharmaceutica Sinica 20120601
Bioorganic & medicinal chemistry letters 20110215
Journal of medicinal chemistry 20100225
Journal of hepatology 20090801
Journal of lipid research 20090601
American journal of physiology. Gastrointestinal and liver physiology 20090301
Journal of medicinal chemistry 20090226