AB52538
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $39.00 | $27.00 | - + | |
5mg | 95% | in stock | $91.00 | $64.00 | - + | |
10mg | 95% | in stock | $126.00 | $88.00 | - + | |
25mg | 95% | in stock | $212.00 | $149.00 | - + | |
50mg | 95% | in stock | $246.00 | $172.00 | - + | |
100mg | 95% | in stock | $356.00 | $249.00 | - + | |
250mg | 95% | in stock | $606.00 | $424.00 | - + | |
1g | 95% | in stock | $2,061.00 | $1,443.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52538 |
Chemical Name: | Asunaprevir |
CAS Number: | 630420-16-5 |
Molecular Formula: | C35H46ClN5O9S |
Molecular Weight: | 748.2858 |
MDL Number: | MFCD27987900 |
SMILES: | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](CN1C(=O)[C@H](C(C)(C)C)NC(=O)OC(C)(C)C)Oc1ncc(c2c1cc(Cl)cc2)OC)C(=O)NS(=O)(=O)C1CC1 |
Complexity: | 1470 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 51 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 14 |
XLogP3: | 4.9 |
Journal of medicinal chemistry 20140313
Hepatology (Baltimore, Md.) 20140201
Antimicrobial agents and chemotherapy 20130301
Antimicrobial agents and chemotherapy 20130301