AG66623
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $49.00 | $35.00 | - + | |
10g | 98% | in stock | $97.00 | $68.00 | - + | |
25g | 98% | in stock | $207.00 | $145.00 | - + | |
100g | 98% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG66623 |
Chemical Name: | 3-Sulfamoylbenzoic acid |
CAS Number: | 636-76-0 |
Molecular Formula: | C7H7NO4S |
Molecular Weight: | 201.19978 |
MDL Number: | MFCD01122318 |
SMILES: | OC(=O)c1cccc(c1)S(=O)(=O)N |
Benzoic acid, 3-(aminosulfonyl)- is a versatile compound used in chemical synthesis for its unique properties. In organic chemistry, it serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound is particularly valued for its ability to introduce the sulfonamide functional group into target molecules, allowing for the modification of their physicochemical properties and bioactivity. The incorporation of the 3-(aminosulfonyl)benzoic acid moiety can enhance the stability, solubility, and biological efficacy of the final products, making it a valuable tool in drug discovery and development. Additionally, this compound can be utilized as a catalyst or additive in certain reactions to facilitate selective transformations or improve overall yields. Its versatility and importance in chemical synthesis make 3-(aminosulfonyl)benzoic acid an indispensable component in the toolkit of synthetic chemists.