AB71477
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $11.00 | $8.00 | - + | |
10g | 98% | in stock | $14.00 | $10.00 | - + | |
25g | 98% | in stock | $20.00 | $14.00 | - + | |
100g | 98% | in stock | $50.00 | $35.00 | - + | |
500g | 98% | in stock | $231.00 | $162.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71477 |
Chemical Name: | Boc-D-Serine |
CAS Number: | 6368-20-3 |
Molecular Formula: | C8H15NO5 |
Molecular Weight: | 205.2084 |
MDL Number: | MFCD26792600 |
SMILES: | OC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 220 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | -0.1 |
N-Boc-D-serine is a versatile compound widely used in chemical synthesis as a building block for the creation of more complex molecules. Due to its unique structure and reactivity, N-Boc-D-serine is commonly employed in the pharmaceutical industry for the synthesis of various drug candidates and active pharmaceutical ingredients. Its Boc (tert-butyloxycarbonyl) protecting group plays a crucial role in controlling the reactivity of the serine moiety, allowing for selective modifications at specific sites. In addition, N-Boc-D-serine can serve as a chiral precursor for the asymmetric synthesis of compounds with defined stereochemistry, making it a valuable tool for the production of enantiopure molecules. Its compatibility with a wide range of chemical reactions further enhances its utility in the development of new materials and compounds with desired properties.