AB71123
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $57.00 | $40.00 | - + | |
250mg | 98% | in stock | $89.00 | $63.00 | - + | |
1g | 98% | in stock | $194.00 | $136.00 | - + | |
5g | >98.0%(T)(HPLC) | in stock | $839.00 | $588.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB71123 |
Chemical Name: | Bindschedler's green leuco base |
CAS Number: | 637-31-0 |
Molecular Formula: | C16H21N3 |
Molecular Weight: | 255.3580 |
MDL Number: | MFCD00059291 |
SMILES: | CN(C)C1=CC=C(C=C1)NC2=CC=C(C=C2)N(C)C |
NSC Number: | 56921 |
Complexity: | 223 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.7 |
Journal of medicinal chemistry 20050113
Bioorganic & medicinal chemistry letters 20000605