AB73948
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $12.00 | $8.00 | - + | |
1g | 98% | in stock | $15.00 | $11.00 | - + | |
5g | 98% | in stock | $37.00 | $26.00 | - + | |
10g | 98% | in stock | $73.00 | $52.00 | - + | |
25g | 98% | in stock | $160.00 | $112.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB73948 |
Chemical Name: | Ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate |
CAS Number: | 64067-99-8 |
Molecular Formula: | C9H8ClN3O2 |
Molecular Weight: | 225.63172000000003 |
MDL Number: | MFCD03086230 |
SMILES: | CCOC(=O)c1cn2c(n1)ccc(n2)Cl |
Complexity: | 252 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.8 |
Ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate is a valuable chemical compound commonly utilized in chemical synthesis processes. This versatile compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Thanks to its unique structure and reactivity, it plays a crucial role in the formation of diverse organic molecules, enabling the development of new materials and compounds with enhanced properties and functionalities. By incorporating Ethyl 6-chloroimidazo[1,2-b]pyridazine-2-carboxylate into synthetic pathways, chemists can access a wide range of molecular scaffolds and introduce specific functional groups, facilitating the custom design and production of novel chemical entities. This compound's applications in chemical synthesis highlight its significance in the creation of innovative products across different industries.