AB48934
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $8.00 | $6.00 | - + | |
250mg | 95% | in stock | $17.00 | $12.00 | - + | |
1g | 95% | in stock | $50.00 | $35.00 | - + | |
5g | 95% | in stock | $240.00 | $168.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48934 |
Chemical Name: | 2'-Fluoro-2'-deoxyadenosine |
CAS Number: | 64183-27-3 |
Molecular Formula: | C10H12FN5O3 |
Molecular Weight: | 269.2324 |
MDL Number: | MFCD09750859 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)F)n1cnc2c1ncnc2N |
Complexity: | 338 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
Bioorganic & medicinal chemistry letters 20120615
Parasitology research 20100901
Protein science : a publication of the Protein Society 20090501
Nature chemical biology 20080101
Biochemistry 20051101
Journal of medicinal chemistry 20040422
Nature 20040205
Journal of molecular biology 20030321
Cancer gene therapy 20030101
Nucleosides, nucleotides & nucleic acids 20030101
Angewandte Chemie (International ed. in English) 20021018
Leukemia research 20020501
Nature 20020321
Journal of medicinal chemistry 19970815
Journal of medicinal chemistry 19930108