AG64314
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $76.00 | $53.00 | - + | |
5g | 98% | in stock | $88.00 | $61.00 | - + | |
10g | 98% | in stock | $106.00 | $74.00 | - + | |
25g | 98% | in stock | $128.00 | $89.00 | - + | |
100g | 98% | in stock | $499.00 | $349.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG64314 |
Chemical Name: | N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine |
CAS Number: | 64325-78-6 |
Molecular Formula: | C38H35N5O6 |
Molecular Weight: | 657.7144 |
MDL Number: | MFCD00010058 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c1ncnc2NC(=O)c1ccccc1 |
N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine is a versatile compound widely utilized in chemical synthesis as a key building block in the creation of nucleoside derivatives. Its unique structure allows for precise modifications and functionalization at specific sites, making it an essential tool in the development of nucleic acid analogs and pharmaceuticals. This compound serves as a crucial intermediate in the synthesis of custom nucleotides and nucleoside analogs, enabling researchers to tailor-make molecules with desired properties for various applications in medicine, biochemistry, and material science.