AB69460
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $18.00 | $13.00 | - + | |
5g | 95% | in stock | $48.00 | $34.00 | - + | |
25g | 95% | in stock | $229.00 | $160.00 | - + | |
100g | 98% | in stock | $869.00 | $608.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69460 |
Chemical Name: | 5-Nitro-2-furoic acid |
CAS Number: | 645-12-5 |
Molecular Formula: | C5H3NO5 |
Molecular Weight: | 157.0810 |
MDL Number: | MFCD00003240 |
SMILES: | OC(=O)c1ccc(o1)[N+](=O)[O-] |
NSC Number: | 6452 |
Complexity: | 186 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1 |
Bioorganic & medicinal chemistry 20110801
Bioorganic & medicinal chemistry 20110115
Bioorganic & medicinal chemistry letters 20100801
Bioorganic & medicinal chemistry letters 20060515
Journal of medicinal chemistry 20051229