AG66455
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $13.00 | $9.00 | - + | |
5mg | 98% | in stock | $32.00 | $22.00 | - + | |
10mg | 98% | in stock | $47.00 | $33.00 | - + | |
100mg | 95% | in stock | $397.00 | $278.00 | - + | |
250mg | 95% | in stock | $633.00 | $444.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG66455 |
Chemical Name: | Vitexin-2″-O-Rhamnoside |
CAS Number: | 64820-99-1 |
Molecular Formula: | C27H30O14 |
Molecular Weight: | 578.5187 |
MDL Number: | MFCD29913069 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)c1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O |
Complexity: | 954 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 10 |
Heavy Atom Count: | 41 |
Hydrogen Bond Acceptor Count: | 14 |
Hydrogen Bond Donor Count: | 9 |
Rotatable Bond Count: | 5 |
XLogP3: | -0.9 |
Bioorganic & medicinal chemistry 20121115
Journal of pharmaceutical and biomedical analysis 20111215
Bioorganic & medicinal chemistry 20110315