AB48665
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | in stock | $8.00 | $5.00 | - + | |
250mg | 95% | in stock | $13.00 | $9.00 | - + | |
1g | 95% | in stock | $33.00 | $23.00 | - + | |
5g | 95% | in stock | $94.00 | $66.00 | - + | |
10g | 95% | in stock | $154.00 | $108.00 | - + | |
25g | 95% | in stock | $338.00 | $237.00 | - + | |
100g | 95% | in stock | $1,022.00 | $716.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48665 |
Chemical Name: | (10R,11R,15R,16S)-16-hydroxy-10-(4-hydroxy-3,5-dimethoxyphenyl)-4,6,13-trioxatetracyclo[7.7.0.0^{3,7}.0^{11,15}]hexadeca-1,3(7),8-trien-12-one |
CAS Number: | 6559-91-7 |
Molecular Formula: | C21H20O8 |
Molecular Weight: | 400.3787 |
MDL Number: | MFCD00189421 |
SMILES: | COc1cc(cc(c1O)OC)[C@H]1[C@H]2C(=O)OC[C@@H]2[C@@H](c2c1cc1OCOc1c2)O |
Complexity: | 614 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.7 |
Science (New York, N.Y.) 20150911
Bioorganic & medicinal chemistry 20121115
Applied microbiology and biotechnology 20120101
Bioprocess and biosystems engineering 20100201
Bioorganic & medicinal chemistry letters 20090201
Biochemistry 20080415
Rapid communications in mass spectrometry : RCM 20080101
Die Pharmazie 20070601
Journal of medicinal chemistry 20050127
Bioorganic & medicinal chemistry letters 20041018
Bioorganic & medicinal chemistry 20040801
Bioorganic & medicinal chemistry 20040615
Journal of medicinal chemistry 20020523