AI66314
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥95% mixture of anomers | in stock | $33.00 | $23.00 | - + | |
5mg | ≥95% mixture of anomers | in stock | $121.00 | $85.00 | - + | |
1g | ~40%(HPLC) | in stock | $156.00 | $109.00 | - + | |
5g | ~40%(HPLC) | in stock | $530.00 | $371.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI66314 |
Chemical Name: | 2,3-(S)-Hexahydroxydiphenoyl-4,6-(S,S)-gallagyl-D-glucose |
CAS Number: | 65995-63-3 |
Molecular Formula: | C48H28O30 |
Molecular Weight: | 1084.7179 |
MDL Number: | MFCD09838017 |
SMILES: | O=CC1OC(=O)c2cc(O)c(c(c2c2c(C(=O)OC1C1OC(=O)c3cc(O)c(c(c3c3c(O)c(O)c4c5c3c(=O)oc3c5c(c(c5c(C(=O)OCC1O)cc(O)c(c5O)O)c(O)c3O)c(=O)o4)O)O)cc(c(c2O)O)O)O)O |