AD04498
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $187.00 | $131.00 | - + | |
250mg | 98% | in stock | $364.00 | $255.00 | - + | |
1g | 98% | in stock | $892.00 | $624.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD04498 |
Chemical Name: | MSX-127 |
CAS Number: | 6616-56-4 |
Molecular Formula: | C16H24N2O4 |
Molecular Weight: | 308.3728 |
MDL Number: | MFCD00087356 |
SMILES: | Oc1cc(CN2CCOCC2)c(cc1CN1CCOCC1)O |
Complexity: | 300 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.1 |
Journal of medicinal chemistry 20071115