AB60400
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $18.00 | $13.00 | - + | |
10g | 95% | in stock | $21.00 | $15.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60400 |
Chemical Name: | 2,5-Dichloro-4-nitroaniline |
CAS Number: | 6627-34-5 |
Molecular Formula: | C6H4Cl2N2O2 |
Molecular Weight: | 207.0142 |
MDL Number: | MFCD00025157 |
SMILES: | Clc1cc([N+](=O)[O-])c(cc1N)Cl |
NSC Number: | 60645 |
Complexity: | 185 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20021010