AB47055
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $28.00 | $20.00 | - + | |
5mg | 99% | in stock | $73.00 | $51.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB47055 |
Chemical Name: | Su9516 |
CAS Number: | 666837-93-0 |
Molecular Formula: | C13H11N3O2 |
Molecular Weight: | 241.2453 |
MDL Number: | MFCD17010284 |
SMILES: | COc1ccc2c(c1)/C(=C/c1c[nH]cn1)/C(=O)N2 |
Complexity: | 369 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
Undefined Bond Stereocenter Count: | 1 |
XLogP3: | 1 |
Journal of medicinal chemistry 20060824
Molecular pharmacology 20060801
Bioorganic & medicinal chemistry letters 20030602
Biochemical pharmacology 20021001
Cancer research 20010815