AH13482
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $26.00 | $18.00 | - + | |
5g | 95% | in stock | $37.00 | $26.00 | - + | |
10g | 98% | in stock | $51.00 | $36.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH13482 |
Chemical Name: | 2-Amino-benzothiazole-6-carboxylic acid methyl ester |
CAS Number: | 66947-92-0 |
Molecular Formula: | C9H8N2O2S |
Molecular Weight: | 208.2370 |
MDL Number: | MFCD00468672 |
SMILES: | COC(=O)c1ccc2c(c1)sc(n2)N |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.9 |
Journal of medicinal chemistry 20090723