AH15044
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | ≥ 95% (HPLC) | in stock | $149.00 | $105.00 | - + | |
1g | 96% | in stock | $251.00 | $176.00 | - + | |
5g | 96% | in stock | $713.00 | $499.00 | - + | |
10g | 96% | in stock | $1,179.00 | $825.00 | - + | |
25g | 96% | in stock | $2,345.00 | $1,642.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH15044 |
Chemical Name: | Boc-Met-Leu-Phe-OH |
CAS Number: | 67247-12-5 |
Molecular Formula: | C25H39N3O6S |
Molecular Weight: | 509.6587 |
MDL Number: | MFCD00037435 |
SMILES: | CSCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)CC(C)C)NC(=O)OC(C)(C)C |
Complexity: | 704 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 15 |
XLogP3: | 2.9 |
Bioorganic & medicinal chemistry letters 20110515
Pharmacology 20090101
Pharmacology 20090101
Bulletin of experimental biology and medicine 20080401
Inflammation 20071201
Canadian journal of microbiology 20040401
Developmental and comparative immunology 20010501
Biology of reproduction 20010301