AD00786
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $33.00 | $24.00 | - + | |
250mg | 96% | in stock | $55.00 | $39.00 | - + | |
1g | 96% | in stock | $147.00 | $103.00 | - + | |
5g | 96% | in stock | $610.00 | $427.00 | - + | |
10g | 96% | in stock | $1,037.00 | $726.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD00786 |
Chemical Name: | 6-((4-(Aminomethyl)benzyl)oxy)-7H-purin-2-amine |
CAS Number: | 674799-96-3 |
Molecular Formula: | C13H14N6O |
Molecular Weight: | 270.2899 |
MDL Number: | MFCD07367624 |
SMILES: | NCc1ccc(cc1)COc1nc(N)nc2c1[nH]cn2 |
Complexity: | 309 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.1 |
Journal of medicinal chemistry 20081127