AB64041
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 97% | in stock | $15.00 | $10.00 | - + | |
100g | 97% | in stock | $31.00 | $22.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB64041 |
Chemical Name: | 3,6-Dibromocarbazole |
CAS Number: | 6825-20-3 |
Molecular Formula: | C12H7Br2N |
Molecular Weight: | 324.9987 |
MDL Number: | MFCD00004961 |
SMILES: | Brc1ccc2c(c1)c1cc(Br)ccc1[nH]2 |
NSC Number: | 121206 |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 4.8 |
3,6-Dibromo-9H-carbazole is a versatile compound that finds common application in chemical synthesis processes. This compound serves as a valuable building block in the creation of various organic molecules due to its unique structural properties. One of the primary uses of 3,6-Dibromo-9H-carbazole is as a key intermediate in the synthesis of organic materials such as liquid crystals, pharmaceuticals, and organic semiconductors. Its brominated structure plays a crucial role in facilitating further functionalization reactions, allowing chemists to tailor the compound for specific applications. Additionally, 3,6-Dibromo-9H-carbazole can serve as a precursory material for the development of novel polymers with desirable properties. Its ability to undergo diverse chemical transformations makes it a valuable tool in the toolkit of synthetic chemists seeking to innovate and create new materials with advanced functionalities.
Acta crystallographica. Section E, Structure reports online 20110301
Acta crystallographica. Section E, Structure reports online 20090201
Acta crystallographica. Section E, Structure reports online 20090201
Acta crystallographica. Section E, Structure reports online 20080801
Molecular diversity 20080501
ChemMedChem 20060801
Journal of the American Chemical Society 20050302
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20020801