AC66498
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $13.00 | $9.00 | - + | |
1g | 96% | in stock | $13.00 | $10.00 | - + | |
5g | 96% | in stock | $37.00 | $26.00 | - + | |
10g | 96% | in stock | $73.00 | $52.00 | - + | |
25g | 96% | in stock | $182.00 | $128.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC66498 |
Chemical Name: | 7-Bromo-5-nitro-1h-indazole |
CAS Number: | 685109-10-8 |
Molecular Formula: | C7H4BrN3O2 |
Molecular Weight: | 242.0296 |
MDL Number: | MFCD03617603 |
SMILES: | [O-][N+](=O)c1cc(Br)c2c(c1)cn[nH]2 |
Complexity: | 220 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.5 |
The synthesis route for 7-Bromo-5-nitro-1H-indazole can start with the compound o-phenylenediamine as the precursor. Here is a stepwise synthetic route: 1. Nitration: Treat o-phenylenediamine with concentrated nitric acid to introduce the nitro group at the 5-position, obtaining 5-nitro-o-phenylenediamine. 2. Cyclization: React the 5-nitro-o-phenylenediamine with a carbon source such as glyoxal or formyl acetic acid to form the indazole ring system through a Schiff base formation followed by ring closure, resulting in 5-nitro-1H-indazole. 3. Bromination: Subject the 5-nitro-1H-indazole to bromination using a suitable brominating agent such as N-bromosuccinimide (NBS) or elemental bromine in the presence of a catalyst like ferric bromide to attain the target compound 7-bromo-5-nitro-1H-indazole. In each step, purification methods such as recrystallization or column chromatography may be employed to isolate the desired products, and reaction conditions (temperature, solvent, time) must be meticulously controlled.