AB48600
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $8.00 | $5.00 | - + | |
5g | 96% | in stock | $22.00 | $15.00 | - + | |
10g | 96% | in stock | $23.00 | $16.00 | - + | |
25g | 96% | in stock | $26.00 | $18.00 | - + | |
100g | 96% | in stock | $72.00 | $50.00 | - + | |
500g | 96% | in stock | $302.00 | $211.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48600 |
Chemical Name: | 1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane |
CAS Number: | 69304-37-6 |
Molecular Formula: | C12H28Cl2OSi2 |
Molecular Weight: | 315.4271 |
MDL Number: | MFCD00009655 |
SMILES: | CC([Si](C(C)C)(O[Si](C(C)C)(C(C)C)Cl)Cl)C |
Complexity: | 203 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 6 |
Bioorganic & medicinal chemistry 20120401
The Journal of organic chemistry 20111021
Chemistry (Weinheim an der Bergstrasse, Germany) 20110301
Organic & biomolecular chemistry 20040321
Nucleosides, nucleotides & nucleic acids 20030101