AB48599
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $24.00 | $17.00 | - + | |
100mg | 95% | in stock | $60.00 | $42.00 | - + | |
1g | 95% | in stock | $401.00 | $281.00 | - + | |
5g | 95% | in stock | $1,178.00 | $824.00 | - + | |
10g | 95% | in stock | $1,878.00 | $1,315.00 | - + | |
25g | 95% | in stock | $3,743.00 | $2,620.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB48599 |
Chemical Name: | (R)-4-Amino-3-(4-chlorophenyl)butanoic acid |
CAS Number: | 69308-37-8 |
Molecular Formula: | C10H12ClNO2 |
Molecular Weight: | 213.6608 |
MDL Number: | MFCD01321057 |
SMILES: | NC[C@@H](c1ccc(cc1)Cl)CC(=O)O |
Complexity: | 191 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | -1 |
Bioorganic & medicinal chemistry letters 20111101
Spinal cord 20110901
The Journal of pharmacology and experimental therapeutics 20090901
Journal of medicinal chemistry 20010524
Nature 19970320