AB50775
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $18.00 | $12.00 | - + | |
5g | 97% | in stock | $55.00 | $38.00 | - + | |
25g | 97% | in stock | $190.00 | $133.00 | - + | |
100g | 97% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50775 |
Chemical Name: | 2-Methoxy-9h-carbazole |
CAS Number: | 6933-49-9 |
Molecular Formula: | C13H11NO |
Molecular Weight: | 197.2325 |
MDL Number: | MFCD09033506 |
SMILES: | COc1ccc2c(c1)[nH]c1c2cccc1 |
Complexity: | 231 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.8 |
Journal of medicinal chemistry 20100708