AH15228
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | in stock | $48.00 | $34.00 | - + | ||
5mg | in stock | $97.00 | $68.00 | - + | ||
10mg | in stock | $151.00 | $106.00 | - + | ||
25mg | in stock | $229.00 | $161.00 | - + | ||
50mg | in stock | $395.00 | $277.00 | - + | ||
100mg | in stock | $555.00 | $389.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH15228 |
Chemical Name: | SB-505124 |
CAS Number: | 694433-59-5 |
Molecular Formula: | C20H21N3O2 |
Molecular Weight: | 335.3996 |
MDL Number: | MFCD20926329 |
SMILES: | Cc1cccc(n1)c1[nH]c(nc1c1ccc2c(c1)OCO2)C(C)(C)C |
Complexity: | 466 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 4.3 |
Journal of medicinal chemistry 20140522
The Biochemical journal 20130415
Disease models & mechanisms 20130301
Kidney international 20121001
Molecular cancer therapeutics 20121001
Developmental biology 20120815
Investigative ophthalmology & visual science 20120807
Nature biotechnology 20111101
European journal of medicinal chemistry 20110901
Bioorganic & medicinal chemistry 20110415
Tissue engineering. Part A 20110401
Bioorganic & medicinal chemistry letters 20100715
Bioorganic & medicinal chemistry 20100615
Pharmacological research 20100401
Molecular vision 20100101
Bioorganic & medicinal chemistry letters 20090815
Biochemical and biophysical research communications 20080711
Gastroenterology 20080601
American journal of physiology. Lung cellular and molecular physiology 20080401
Bioorganic & medicinal chemistry letters 20080315
Developmental biology 20070915
Journal of medicinal chemistry 20070628
BMC developmental biology 20070101
Molecular pharmacology 20040301