AB70179
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $20.00 | $14.00 | - + | |
10g | 98% | in stock | $27.00 | $19.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70179 |
Chemical Name: | 7-Nitroindole |
CAS Number: | 6960-42-5 |
Molecular Formula: | C8H6N2O2 |
Molecular Weight: | 162.1454 |
MDL Number: | MFCD00005683 |
SMILES: | [O-][N+](=O)c1cccc2c1[nH]cc2 |
NSC Number: | 69874 |
Complexity: | 190 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.6 |
7-Nitro-1H-indole is a versatile compound that finds wide application in chemical synthesis, specifically in the pharmaceutical and agrochemical industries. This compound serves as a key building block for the synthesis of various biologically active molecules due to its unique structure and reactivity. In chemical synthesis, 7-Nitro-1H-indole can be utilized as a precursor for the preparation of indole derivatives, which are important structural motifs found in many natural products and pharmaceutical compounds. Its nitro group can be selectively modified to introduce different functional groups, allowing for the generation of diverse chemical libraries for drug discovery purposes. Furthermore, 7-Nitro-1H-indole can participate in a variety of reactions such as nucleophilic substitution, reduction, and condensation reactions, enabling the creation of complex molecular frameworks with high efficacy and selectivity. Its presence in the synthesis of heterocyclic compounds contributes significantly to the development of new drugs, pesticides, and other bioactive molecules with potential applications in the fields of medicine and agriculture.
The Journal of organic chemistry 20111104
Glia 20110201
Molecular pain 20110101