AB42952
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $8.00 | $5.00 | - + | |
5g | 97% | in stock | $13.00 | $9.00 | - + | |
10g | 97% | in stock | $23.00 | $16.00 | - + | |
25g | 97% | in stock | $49.00 | $35.00 | - + | |
100g | 97% | in stock | $195.00 | $136.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42952 |
Chemical Name: | N-Boc-L-prolinal |
CAS Number: | 69610-41-9 |
Molecular Formula: | C10H17NO3 |
Molecular Weight: | 199.2469 |
MDL Number: | MFCD00274186 |
SMILES: | O=C[C@@H]1CCCN1C(=O)OC(C)(C)C |
Complexity: | 232 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.2 |
PloS one 20090101
Nuclear medicine and biology 20080401