AB44683
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $13.00 | $9.00 | - + | |
10mg | 98% | in stock | $19.00 | $14.00 | - + | |
25mg | 98% | in stock | $31.00 | $22.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44683 |
Chemical Name: | 4-[2-(6-Methylpyridin-2-yl)-4H,5H,6H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline-6-carboxamide |
CAS Number: | 700874-72-2 |
Molecular Formula: | C22H19N5O |
Molecular Weight: | 369.4192 |
MDL Number: | MFCD12923319 |
SMILES: | Cc1cccc(n1)c1nn2c(c1c1ccnc3c1cc(cc3)C(=O)N)CCC2 |
Complexity: | 585 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.4 |
Toxicology and applied pharmacology 20180801
Archives of toxicology 20180701
Oncotarget 20180123
Journal of medicinal chemistry 20140522
Journal of medicinal chemistry 20080410