AB69362
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $11.00 | $8.00 | - + | |
1g | 97% | in stock | $13.00 | $9.00 | - + | |
5g | 97% | in stock | $15.00 | $11.00 | - + | |
10g | 97% | in stock | $21.00 | $15.00 | - + | |
25g | 97% | in stock | $47.00 | $33.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69362 |
Chemical Name: | 5-Methoxy-2-nitrophenol |
CAS Number: | 704-14-3 |
Molecular Formula: | C7H7NO4 |
Molecular Weight: | 169.13478000000003 |
MDL Number: | MFCD00100932 |
SMILES: | COc1ccc(c(c1)O)[N+](=O)[O-] |
NSC Number: | 1167 |
Complexity: | 167 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2 |
5-Methoxy-2-nitrophenol, also known as 5-Methyl-2-nitrophenol, is a versatile compound widely used in chemical synthesis as a key intermediate. This compound plays a crucial role in the production of various organic compounds due to its unique structure and reactivity. In particular, 5-Methoxy-2-nitrophenol is commonly employed in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals.One of the primary applications of 5-Methoxy-2-nitrophenol in chemical synthesis is as a building block in the creation of complex molecules. Its nitro group can undergo various chemical transformations, such as reduction or substitution reactions, to introduce different functional groups into the molecule. This versatility makes 5-Methoxy-2-nitrophenol a valuable tool in the design and synthesis of biologically active compounds.Furthermore, 5-Methoxy-2-nitrophenol can also serve as a precursor for the synthesis of dyes and pigments. By utilizing its phenolic and nitro functionalities, chemists can modify the compound to generate a wide range of colorants with different shades and properties. This application highlights the importance of 5-Methoxy-2-nitrophenol in the field of organic synthesis and materials science.Additionally, the presence of the methoxy group in 5-Methoxy-2-nitrophenol enhances its solubility in organic solvents, making it a suitable reagent for reactions carried out in non-aqueous media. This feature expands the utility of this compound in various synthetic processes, allowing chemists to explore new reaction pathways and improve overall efficiency in chemical transformations.Overall, the diverse applications of 5-Methoxy-2-nitrophenol in chemical synthesis underscore its significance as a key intermediate in the production of valuable compounds across different industries. Its unique structural features and reactivity make it a valuable asset for chemists seeking to develop innovative synthetic strategies and enhance their capabilities in organic chemistry.