AB44726
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $19.00 | $14.00 | - + | |
5g | 98% | in stock | $262.00 | $184.00 | - + | |
10g | 98% | in stock | $428.00 | $299.00 | - + | |
25g | 98% | in stock | $622.00 | $435.00 | - + | |
100g | 98% | in stock | $1,876.00 | $1,314.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44726 |
Chemical Name: | 4-(Methanesulfonylamino)benzoic acid |
CAS Number: | 7151-76-0 |
Molecular Formula: | C8H9NO4S |
Molecular Weight: | 215.2264 |
MDL Number: | MFCD00025052 |
SMILES: | OC(=O)c1ccc(cc1)NS(=O)(=O)C |
NSC Number: | 70313 |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.7 |
Journal of medicinal chemistry 19971205