AC53295
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $14.00 | $10.00 | - + | |
250mg | 98% | in stock | $18.00 | $13.00 | - + | |
1g | 98% | in stock | $28.00 | $20.00 | - + | |
5g | 98% | in stock | $139.00 | $98.00 | - + | |
10g | 98% | in stock | $276.00 | $194.00 | - + | |
25g | 98% | in stock | $689.00 | $483.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC53295 |
Chemical Name: | 5-Bromo-6-nitro-1h-indazole |
CAS Number: | 71785-49-4 |
Molecular Formula: | C7H4BrN3O2 |
Molecular Weight: | 242.0296 |
MDL Number: | MFCD09027584 |
SMILES: | [O-][N+](=O)c1cc2[nH]ncc2cc1Br |
Complexity: | 220 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.1 |
5-Bromo-6-nitro-1H-indazole is a versatile chemical reagent widely used in chemical synthesis. Its unique structure and properties make it a valuable building block in the preparation of various organic compounds. One of the key applications of this compound is in the synthesis of pharmaceutical intermediates. By incorporating 5-Bromo-6-nitro-1H-indazole into the molecule structure, chemists can modify the physicochemical properties of the resulting compounds, enhancing their bioactivity and pharmacokinetic profiles. Additionally, this compound can be utilized in the preparation of heterocyclic compounds, which are essential in drug discovery and development. The presence of both bromine and nitro groups in 5-Bromo-6-nitro-1H-indazole makes it a valuable electrophilic and nucleophilic building block for various types of chemical reactions, allowing for the efficient construction of complex molecular structures.