AC53138
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $42.00 | $29.00 | - + | |
10mg | 98% | in stock | $118.00 | $82.00 | - + | |
50mg | 98% | in stock | $199.00 | $139.00 | - + | |
100mg | 98% | in stock | $318.00 | $222.00 | - + | |
250mg | 98% | in stock | $536.00 | $375.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC53138 |
Chemical Name: | N-Methyl-N-[2-[[[2-[(2-oxo-2,3-dihydro-1H-indol-5-yl)amino]-5-trifluoromethylpyrimidin-4-yl]amino]methyl]phenyl]methanesulfonamide |
CAS Number: | 717906-29-1 |
Molecular Formula: | C22H21F3N6O3S |
Molecular Weight: | 506.5007 |
MDL Number: | MFCD16038300 |
SMILES: | O=C1Nc2c(C1)cc(cc2)Nc1ncc(c(n1)NCc1ccccc1N(S(=O)(=O)C)C)C(F)(F)F |
Complexity: | 854 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 11 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 2.8 |
Journal of medicinal chemistry 20100610
Bioorganic & medicinal chemistry letters 20090615
The Journal of biological chemistry 20090508