AB46684
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $5.00 | $3.00 | - + | |
5g | 98% | in stock | $8.00 | $6.00 | - + | |
10g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | ≥98% | in stock | $22.00 | $15.00 | - + | |
100g | 98% | in stock | $56.00 | $39.00 | - + | |
500g | 98% | in stock | $208.00 | $146.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46684 |
Chemical Name: | Fmoc-Lys(Boc)-OH |
CAS Number: | 71989-26-9 |
Molecular Formula: | C26H32N2O6 |
Molecular Weight: | 468.5421 |
MDL Number: | MFCD00037138 |
SMILES: | O=C(N[C@H](C(=O)O)CCCCNC(=O)OC(C)(C)C)OCC1c2ccccc2c2c1cccc2 |
Complexity: | 684 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 12 |
XLogP3: | 4.5 |
Bioorganic & medicinal chemistry letters 20050301
Journal of combinatorial chemistry 20010101