AB46182
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $8.00 | $5.00 | - + | |
10g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | 98% | in stock | $19.00 | $13.00 | - + | |
100g | 98% | in stock | $48.00 | $33.00 | - + | |
500g | 98% | in stock | $230.00 | $161.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46182 |
Chemical Name: | Fmoc-Ser(tBu)-OH |
CAS Number: | 71989-33-8 |
Molecular Formula: | C22H25NO5 |
Molecular Weight: | 383.4376 |
MDL Number: | MFCD00037127 |
SMILES: | O=C(N[C@H](C(=O)O)COC(C)(C)C)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 536 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 8 |
XLogP3: | 3.5 |
L-Serine, O-(1,1-dimethylethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl] is a key intermediary compound in chemical synthesis processes. This compound is commonly utilized in organic chemistry as a protecting group for amino acids, particularly for the selective protection of serine residues during peptide synthesis. The tert-butyl ester group attached to the serine molecule provides stability and protection to the reactive functional groups, allowing for controlled reactions and manipulation of the peptide chain. This compound plays a crucial role in the efficient and precise assembly of complex peptides and proteins in laboratories and pharmaceutical settings.