AH16195
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $17.00 | $12.00 | - + | |
250mg | 95% | in stock | $41.00 | $29.00 | - + | |
1g | 95% | in stock | $120.00 | $84.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH16195 |
Chemical Name: | H-Phe-gly-oh |
CAS Number: | 721-90-4 |
Molecular Formula: | C11H14N2O3 |
Molecular Weight: | 222.2405 |
MDL Number: | MFCD00021728 |
SMILES: | N[C@H](C(=O)NCC(=O)O)Cc1ccccc1 |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | -2.5 |
Bioorganic & medicinal chemistry letters 20121201
Chemical research in toxicology 20120917
Biochimica et biophysica acta 20120201
Bioorganic & medicinal chemistry 20110801
Nature chemical biology 20090101
Journal of medicinal chemistry 20060615
Archives of biochemistry and biophysics 20050301
Journal of the American Chemical Society 20050119
Journal of medicinal chemistry 20040212
Experimental cell research 20031101
International journal of pharmaceutics 20030102
Drug metabolism and pharmacokinetics 20030101
The Journal of organic chemistry 20021227
Toxicology 19910325