BG25593
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $382.00 | $267.00 | - + | |
250mg | 95% | in stock | $509.00 | $356.00 | - + | |
500mg | 95% | in stock | $713.00 | $499.00 | - + | |
1g | 95% | in stock | $1,018.00 | $712.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BG25593 |
Chemical Name: | Phenylmethyl (3S,4S)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-3-hydroxy-1-piperidine carboxylate |
CAS Number: | 724787-54-6 |
Molecular Formula: | C18H26N2O5 |
Molecular Weight: | 350.4094 |
MDL Number: | MFCD18070796 |
SMILES: | O=C(OC(C)(C)C)N[C@H]1CCN(C[C@@H]1O)C(=O)OCc1ccccc1 |
Phenylmethyl (3S,4S)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-3-hydroxy-1-piperidinecarboxylate is a versatile compound used in chemical synthesis for the preparation of various pharmaceutical intermediates and fine chemicals. Its unique structure allows for selective functionalization at the hydroxy, amino, and carbonyl groups, making it an essential building block in organic synthesis. This compound is particularly valuable in the development of novel drug molecules, as it offers a strategic entry point for the introduction of diverse functional groups and stereochemistry control. Its application in chemical synthesis extends to the production of complex molecules with tailored properties, enabling researchers to explore new avenues in drug discovery and material science.