AB66184
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $12.00 | $9.00 | - + | |
5g | 98% | in stock | $27.00 | $19.00 | - + | |
25g | 98% | in stock | $129.00 | $90.00 | - + | |
100g | 98% | in stock | $350.00 | $245.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB66184 |
Chemical Name: | Bis(4-Methoxyphenyl)methanol |
CAS Number: | 728-87-0 |
Molecular Formula: | C15H16O3 |
Molecular Weight: | 244.2857 |
MDL Number: | MFCD00008410 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)O |
NSC Number: | 5256 |
Complexity: | 204 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.7 |
Physical chemistry chemical physics : PCCP 20080107
The journal of physical chemistry. A 20050811