AB46796
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $13.00 | $9.00 | - + | |
5g | 95% | in stock | $16.00 | $11.00 | - + | |
10g | 95% | in stock | $20.00 | $14.00 | - + | |
25g | 95% | in stock | $39.00 | $27.00 | - + | |
100g | 95% | in stock | $139.00 | $97.00 | - + | |
500g | 95% | in stock | $619.00 | $433.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46796 |
Chemical Name: | O-Diphenylphosphinylhydroxylamine |
CAS Number: | 72804-96-7 |
Molecular Formula: | C12H12NO2P |
Molecular Weight: | 233.2029 |
MDL Number: | MFCD12755701 |
SMILES: | NOP(=O)(c1ccccc1)c1ccccc1 |
Complexity: | 236 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.8 |
The Journal of organic chemistry 20121019