AH15177
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $22.00 | $15.00 | - + | |
5mg | 98% | in stock | $78.00 | $55.00 | - + | |
10mg | 98% | in stock | $95.00 | $66.00 | - + | |
25mg | 98% | in stock | $160.00 | $112.00 | - + | |
50mg | 98% | in stock | $273.00 | $191.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH15177 |
Chemical Name: | BMS-707035 |
CAS Number: | 729607-74-3 |
Molecular Formula: | C17H19FN4O5S |
Molecular Weight: | 410.42 |
MDL Number: | MFCD18074518 |
SMILES: | Fc1ccc(cc1)CNC(=O)c1nc(n(c(=O)c1O)C)N1CCCCS1(=O)=O |
Complexity: | 812 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 1 |
The Journal of biological chemistry 20071026