AX45383
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 98% | 2 weeks | $22.00 | $15.00 | - + | |
100g | 98% | 2 weeks | $36.00 | $25.00 | - + | |
250g | 98% | 2 weeks | $54.00 | $38.00 | - + | |
500g | 98% | 2 weeks | $62.00 | $44.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX45383 |
Chemical Name: | Glycerides, mixed decanoyl and octanoyl |
CAS Number: | 73398-61-5 |
Molecular Formula: | C21H39O6 |
Molecular Weight: | 387.5308 |
SMILES: | CCCCCCC(C(=O)OCC(CO)O)CCCCCCCCCC(=O)[O-] |