AC50528
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 99% | in stock | $6.00 | $4.00 | - + | |
25g | 99% | in stock | $12.00 | $9.00 | - + | |
100g | 99% | in stock | $43.00 | $30.00 | - + | |
500g | 99% | in stock | $72.00 | $51.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC50528 |
Chemical Name: | 3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid |
CAS Number: | 73463-39-5 |
Molecular Formula: | C9H19NO4S |
Molecular Weight: | 237.3165 |
MDL Number: | MFCD00041778 |
SMILES: | OC(CS(=O)(=O)O)CNC1CCCCC1 |
Complexity: | 266 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | -2.4 |
Acta crystallographica. Section D, Biological crystallography 20110501
Physical chemistry chemical physics : PCCP 20110321
Molecular vision 20070101
Electrophoresis 20061101
Journal of chromatography. A 20041008
Biotechnology and bioengineering 20031020
Journal of chromatography. A 20010504