AH15246
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $35.00 | $24.00 | - + | |
5mg | 95% | in stock | $42.00 | $29.00 | - + | |
10mg | 95% | in stock | $65.00 | $45.00 | - + | |
100mg | 95% | in stock | $83.00 | $58.00 | - + | |
250mg | 95% | in stock | $139.00 | $97.00 | - + | |
1g | 95% | in stock | $343.00 | $240.00 | - + | |
5g | 95% | in stock | $1,029.00 | $720.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH15246 |
Chemical Name: | ETC-1002 |
CAS Number: | 738606-46-7 |
Molecular Formula: | C19H36O5 |
Molecular Weight: | 344.48614 |
MDL Number: | MFCD18800820 |
SMILES: | OC(CCCCCC(C(=O)O)(C)C)CCCCCC(C(=O)O)(C)C |
Complexity: | 351 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 14 |
XLogP3: | 4.8 |
8-Hydroxy-2,2,14,14-tetramethylpentadecanedioic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. Its unique molecular structure allows for various functionalization processes, making it a valuable intermediate in the development of novel compounds and materials. In particular, $name$ is frequently employed in the synthesis of specialized polymers, pharmaceuticals, and agrochemicals due to its ability to introduce specific functionalities and enhance the properties of the final products. By incorporating 8-Hydroxy-2,2,14,14-tetramethylpentadecanedioic acid into organic synthesis reactions, chemists can access a wide range of structurally diverse molecules with tailored properties for specific applications.
European journal of biochemistry 19920301