logo
Home  > Inhibitors/Agonists  > PI3K/Akt/mTOR  > AMPK  > ETC-1002

AH15246

738606-46-7 | ETC-1002

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $25.00 $18.00 -   +
5mg 95% in stock $42.00 $29.00 -   +
10mg 95% in stock $65.00 $45.00 -   +
100mg 95% in stock $83.00 $58.00 -   +
250mg 95% in stock $138.00 $96.00 -   +
1g 95% in stock $343.00 $240.00 -   +
5g 95% in stock $1,029.00 $720.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AH15246
Chemical Name: ETC-1002
CAS Number: 738606-46-7
Molecular Formula: C19H36O5
Molecular Weight: 344.48614
MDL Number: MFCD18800820
SMILES: OC(CCCCCC(C(=O)O)(C)C)CCCCCC(C(=O)O)(C)C

 

Computed Properties
Complexity: 351  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 24  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 14  
XLogP3: 4.8  

 

 

Upstream Synthesis Route
  • 8-Hydroxy-2,2,14,14-tetramethylpentadecanedioic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. Its unique molecular structure allows for various functionalization processes, making it a valuable intermediate in the development of novel compounds and materials. In particular, $name$ is frequently employed in the synthesis of specialized polymers, pharmaceuticals, and agrochemicals due to its ability to introduce specific functionalities and enhance the properties of the final products. By incorporating 8-Hydroxy-2,2,14,14-tetramethylpentadecanedioic acid into organic synthesis reactions, chemists can access a wide range of structurally diverse molecules with tailored properties for specific applications.
Literature
FEATURED PRODUCTS